C14H12F18O2 — CID 175043633
5-tert-butylperoxy-1,1,1,2,2,3,3,4,4,7,7,8,8,9,9,10,10,10-octadecafluorodecane (PubChem CID 175043633) has the molecular formula C14H12F18O2 and a molecular weight of 554.21 g/mol. Its IUPAC name is 5-tert-butylperoxy-1,1,1,2,2,3,3,4,4,7,7,8,8,9,9,10,10,10-octadecafluorodecane.
| Compound Name | 5-tert-butylperoxy-1,1,1,2,2,3,3,4,4,7,7,8,8,9,9,10,10,10-octadecafluorodecane |
|---|---|
| PubChem CID | 175043633 |
| Molecular Formula | C14H12F18O2 |
| Molecular Weight | 554.21 g/mol |
| Exact Mass | 554.05 |
| IUPAC Name | 5-tert-butylperoxy-1,1,1,2,2,3,3,4,4,7,7,8,8,9,9,10,10,10-octadecafluorodecane |
| SMILES | CC(C)(C)OOC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F18O2/c1-6(2,3)34-33-5(8(17,18)10(21,22)12(25,26)14(30,31)32)4-7(15,16)9(19,20)11(23,24)13(27,28)29/h5H,4H2,1-3H3 |
| InChIKey | OYEIXJYDZWBOOH-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.21 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|