C18H17F13O2 — CID 156764773
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]octan-1-ol (PubChem CID 156764773) has the molecular formula C18H17F13O2 and a molecular weight of 512.31 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]octan-1-ol.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]octan-1-ol |
|---|---|
| PubChem CID | 156764773 |
| Molecular Formula | C18H17F13O2 |
| Molecular Weight | 512.31 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]octan-1-ol |
| SMILES | CC(C)(C)Oc1ccc(C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F13O2/c1-12(2,3)33-10-6-4-9(5-7-10)11(32)8-13(19,20)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)31/h4-7,11,32H,8H2,1-3H3 |
| InChIKey | GBMVDMUQXDHYFP-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.31 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|