C14H8BrF13O — CID 156765452
1-(4-bromophenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol (PubChem CID 156765452) has the molecular formula C14H8BrF13O and a molecular weight of 519.10 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol.
| Compound Name | 1-(4-bromophenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol |
|---|---|
| PubChem CID | 156765452 |
| Molecular Formula | C14H8BrF13O |
| Molecular Weight | 519.10 g/mol |
| Exact Mass | 517.96 |
| IUPAC Name | 1-(4-bromophenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol |
| SMILES | OC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H8BrF13O/c15-7-3-1-6(2-4-7)8(29)5-9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)28/h1-4,8,29H,5H2 |
| InChIKey | ZNJZKYYPQQZOGF-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.10 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|