C15H11F13O2 — CID 156764544
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-(4-methoxyphenyl)octan-1-ol (PubChem CID 156764544) has the molecular formula C15H11F13O2 and a molecular weight of 470.23 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-(4-methoxyphenyl)octan-1-ol.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-(4-methoxyphenyl)octan-1-ol |
|---|---|
| PubChem CID | 156764544 |
| Molecular Formula | C15H11F13O2 |
| Molecular Weight | 470.23 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-(4-methoxyphenyl)octan-1-ol |
| SMILES | COc1ccc(C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H11F13O2/c1-30-8-4-2-7(3-5-8)9(29)6-10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h2-5,9,29H,6H2,1H3 |
| InChIKey | CWPPESVWAHKNEK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.23 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|