C20H15F9O2 — CID 165389854
4,4,5,5,6,6,7,7,7-nonafluoro-2-(4-methoxyphenyl)-1-phenylheptan-1-one (PubChem CID 165389854) has the molecular formula C20H15F9O2 and a molecular weight of 458.32 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,7-nonafluoro-2-(4-methoxyphenyl)-1-phenylheptan-1-one.
| Compound Name | 4,4,5,5,6,6,7,7,7-nonafluoro-2-(4-methoxyphenyl)-1-phenylheptan-1-one |
|---|---|
| PubChem CID | 165389854 |
| Molecular Formula | C20H15F9O2 |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 4,4,5,5,6,6,7,7,7-nonafluoro-2-(4-methoxyphenyl)-1-phenylheptan-1-one |
| SMILES | COc1ccc(C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15F9O2/c1-31-14-9-7-12(8-10-14)15(16(30)13-5-3-2-4-6-13)11-17(21,22)18(23,24)19(25,26)20(27,28)29/h2-10,15H,11H2,1H3 |
| InChIKey | VSQSWXHYJWGTJE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|