C16H14F12O4 — CID 95906606
(1S)-4,4,4-trifluoro-1-[4-[(1S)-4,4,4-trifluoro-1,3-dihydroxy-3-(trifluoromethyl)butyl]phenyl]-3-(trifluoromethyl)butane-1,3-diol (PubChem CID 95906606) has the molecular formula C16H14F12O4 and a molecular weight of 498.26 g/mol. Its IUPAC name is (1S)-4,4,4-trifluoro-1-[4-[(1S)-4,4,4-trifluoro-1,3-dihydroxy-3-(trifluoromethyl)butyl]phenyl]-3-(trifluoromethyl)butane-1,3-diol.
| Compound Name | (1S)-4,4,4-trifluoro-1-[4-[(1S)-4,4,4-trifluoro-1,3-dihydroxy-3-(trifluoromethyl)butyl]phenyl]-3-(trifluoromethyl)butane-1,3-diol |
|---|---|
| PubChem CID | 95906606 |
| Molecular Formula | C16H14F12O4 |
| Molecular Weight | 498.26 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | (1S)-4,4,4-trifluoro-1-[4-[(1S)-4,4,4-trifluoro-1,3-dihydroxy-3-(trifluoromethyl)butyl]phenyl]-3-(trifluoromethyl)butane-1,3-diol |
| SMILES | O[C@@H](CC(O)(C(F)(F)F)C(F)(F)F)c1ccc([C@@H](O)CC(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F12O4/c17-13(18,19)11(31,14(20,21)22)5-9(29)7-1-2-8(4-3-7)10(30)6-12(32,15(23,24)25)16(26,27)28/h1-4,9-10,29-32H,5-6H2/t9-,10-/m0/s1 |
| InChIKey | SUQZIKNKPDXXJX-UWVGGRQHSA-N |
| XLogP | 4.24 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |