C10H10F4O — CID 164681881
3,3,4,4-tetrafluoro-1-phenylbutan-1-ol (PubChem CID 164681881) has the molecular formula C10H10F4O and a molecular weight of 222.18 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1-phenylbutan-1-ol.
| Compound Name | 3,3,4,4-tetrafluoro-1-phenylbutan-1-ol |
|---|---|
| PubChem CID | 164681881 |
| Molecular Formula | C10H10F4O |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1-phenylbutan-1-ol |
| SMILES | OC(CC(F)(F)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H10F4O/c11-9(12)10(13,14)6-8(15)7-4-2-1-3-5-7/h1-5,8-9,15H,6H2 |
| InChIKey | XKNZZYGSMMDLEE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|