C11H13F3O2 — CID 79423436
5,5,5-trifluoro-1-phenylpentane-1,4-diol (PubChem CID 79423436) has the molecular formula C11H13F3O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-phenylpentane-1,4-diol.
| Compound Name | 5,5,5-trifluoro-1-phenylpentane-1,4-diol |
|---|---|
| PubChem CID | 79423436 |
| Molecular Formula | C11H13F3O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5,5,5-trifluoro-1-phenylpentane-1,4-diol |
| SMILES | OC(CCC(O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H13F3O2/c12-11(13,14)10(16)7-6-9(15)8-4-2-1-3-5-8/h1-5,9-10,15-16H,6-7H2 |
| InChIKey | LZMIISAUYBREAM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |