C13H12F8O2 — CID 12839498
bis(2,2,3,3-tetrafluoropropoxy)methylbenzene (PubChem CID 12839498) has the molecular formula C13H12F8O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is bis(2,2,3,3-tetrafluoropropoxy)methylbenzene.
| Compound Name | bis(2,2,3,3-tetrafluoropropoxy)methylbenzene |
|---|---|
| PubChem CID | 12839498 |
| Molecular Formula | C13H12F8O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | bis(2,2,3,3-tetrafluoropropoxy)methylbenzene |
| SMILES | FC(F)C(F)(F)COC(OCC(F)(F)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H12F8O2/c14-10(15)12(18,19)6-22-9(8-4-2-1-3-5-8)23-7-13(20,21)11(16)17/h1-5,9-11H,6-7H2 |
| InChIKey | YAAHZLCTCYVQOE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|