C14H17F5O2 — CID 172679512
3,3,4,4-tetrafluoro-1-[3-fluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]butan-1-ol (PubChem CID 172679512) has the molecular formula C14H17F5O2 and a molecular weight of 312.28 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1-[3-fluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]butan-1-ol.
| Compound Name | 3,3,4,4-tetrafluoro-1-[3-fluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 172679512 |
| Molecular Formula | C14H17F5O2 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1-[3-fluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]butan-1-ol |
| SMILES | CC(C)(C)Oc1ccc(C(O)CC(F)(F)C(F)F)cc1F |
| InChI | InChI=1S/C14H17F5O2/c1-13(2,3)21-11-5-4-8(6-9(11)15)10(20)7-14(18,19)12(16)17/h4-6,10,12,20H,7H2,1-3H3 |
| InChIKey | AEZCKLBHBCYFIL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|