C9H14O8P2 — CID 13487796
(1,3-dihydroxy-3-phenyl-1-phosphonopropyl)phosphonic acid (PubChem CID 13487796) has the molecular formula C9H14O8P2 and a molecular weight of 312.15 g/mol. Its IUPAC name is (1,3-dihydroxy-3-phenyl-1-phosphonopropyl)phosphonic acid.
| Compound Name | (1,3-dihydroxy-3-phenyl-1-phosphonopropyl)phosphonic acid |
|---|---|
| PubChem CID | 13487796 |
| Molecular Formula | C9H14O8P2 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | (1,3-dihydroxy-3-phenyl-1-phosphonopropyl)phosphonic acid |
| SMILES | O=P(O)(O)C(O)(CC(O)c1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C9H14O8P2/c10-8(7-4-2-1-3-5-7)6-9(11,18(12,13)14)19(15,16)17/h1-5,8,10-11H,6H2,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | CLIDPHDIUMOTKS-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|