C8H8Cl3O3P — CID 159173416
(1,1,2-trichloro-2-phenylethyl)phosphonic acid (PubChem CID 159173416) has the molecular formula C8H8Cl3O3P and a molecular weight of 289.48 g/mol. Its IUPAC name is (1,1,2-trichloro-2-phenylethyl)phosphonic acid.
| Compound Name | (1,1,2-trichloro-2-phenylethyl)phosphonic acid |
|---|---|
| PubChem CID | 159173416 |
| Molecular Formula | C8H8Cl3O3P |
| Molecular Weight | 289.48 g/mol |
| Exact Mass | 287.93 |
| IUPAC Name | (1,1,2-trichloro-2-phenylethyl)phosphonic acid |
| SMILES | O=P(O)(O)C(Cl)(Cl)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C8H8Cl3O3P/c9-7(6-4-2-1-3-5-6)8(10,11)15(12,13)14/h1-5,7H,(H2,12,13,14) |
| InChIKey | KLYZOUKACMTANH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|