About (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol
(E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol (PubChem CID 11254199) has the molecular formula C13H17BrO
and a molecular weight of 269.18 g/mol. Its IUPAC name is (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol.
Molecular Properties
| Compound Name | (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol |
| PubChem CID | 11254199 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol |
| SMILES | CC(C)(C)/C=C/[C@H](O)c1ccccc1Br |
| InChI | InChI=1S/C13H17BrO/c1-13(2,3)9-8-12(15)10-6-4-5-7-11(10)14/h4-9,12,15H,1-3H3/b9-8+/t12-/m0/s1 |
| InChIKey | KTGPVHNVXWXIBP-BCPZQOPPSA-N |
| XLogP | 4.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol?
The IUPAC name of (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol (CID 11254199) is (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol.
What is the SMILES notation for (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol?
The canonical SMILES for (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol is CC(C)(C)/C=C/[C@H](O)c1ccccc1Br.
What is the InChIKey of (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol?
The InChIKey is KTGPVHNVXWXIBP-BCPZQOPPSA-N. The full InChI is InChI=1S/C13H17BrO/c1-13(2,3)9-8-12(15)10-6-4-5-7-11(10)14/h4-9,12,15H,1-3H3/b9-8+/t12-/m0/s1.
What are the key properties of (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol?
(E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol has a molecular weight of 269.18 g/mol, XLogP of 4.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol is sourced from PubChem (CID 11254199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).