C13H17BrO — CID 11254199
(E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol (PubChem CID 11254199) has the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. Its IUPAC name is (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol.
| Compound Name | (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol |
|---|---|
| PubChem CID | 11254199 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | (E,1S)-1-(2-bromophenyl)-4,4-dimethylpent-2-en-1-ol |
| SMILES | CC(C)(C)/C=C/[C@H](O)c1ccccc1Br |
| InChI | InChI=1S/C13H17BrO/c1-13(2,3)9-8-12(15)10-6-4-5-7-11(10)14/h4-9,12,15H,1-3H3/b9-8+/t12-/m0/s1 |
| InChIKey | KTGPVHNVXWXIBP-BCPZQOPPSA-N |
| XLogP | 4.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|