About 3-(2-bromophenyl)-2,2-difluoro-3-hydroxypropanenitrile
3-(2-bromophenyl)-2,2-difluoro-3-hydroxypropanenitrile (PubChem CID 62706757) has the molecular formula C9H6BrF2NO
and a molecular weight of 262.05 g/mol. Its IUPAC name is 3-(2-bromophenyl)-2,2-difluoro-3-hydroxypropanenitrile.
Analyze 3-(2-bromophenyl)-2,2-difluoro-3-hydroxypropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromophenyl)-2,2-difluoro-3-hydroxypropanenitrile?
The IUPAC name of 3-(2-bromophenyl)-2,2-difluoro-3-hydroxypropanenitrile (CID 62706757) is 3-(2-bromophenyl)-2,2-difluoro-3-hydroxypropanenitrile.
What is the SMILES notation for 3-(2-bromophenyl)-2,2-difluoro-3-hydroxypropanenitrile?
The canonical SMILES for 3-(2-bromophenyl)-2,2-difluoro-3-hydroxypropanenitrile is N#CC(F)(F)C(O)c1ccccc1Br.
What is the InChIKey of 3-(2-bromophenyl)-2,2-difluoro-3-hydroxypropanenitrile?
The InChIKey is CSNANUWLEZXQRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrF2NO/c10-7-4-2-1-3-6(7)8(14)9(11,12)5-13/h1-4,8,14H.
What are the key properties of 3-(2-bromophenyl)-2,2-difluoro-3-hydroxypropanenitrile?
3-(2-bromophenyl)-2,2-difluoro-3-hydroxypropanenitrile has a molecular weight of 262.05 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromophenyl)-2,2-difluoro-3-hydroxypropanenitrile is sourced from PubChem (CID 62706757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).