C14H16BrNO — CID 55118131
2-(2-bromophenyl)-4,4-dimethyl-3-oxohexanenitrile (PubChem CID 55118131) has the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. Its IUPAC name is 2-(2-bromophenyl)-4,4-dimethyl-3-oxohexanenitrile.
| Compound Name | 2-(2-bromophenyl)-4,4-dimethyl-3-oxohexanenitrile |
|---|---|
| PubChem CID | 55118131 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-(2-bromophenyl)-4,4-dimethyl-3-oxohexanenitrile |
| SMILES | CCC(C)(C)C(=O)C(C#N)c1ccccc1Br |
| InChI | InChI=1S/C14H16BrNO/c1-4-14(2,3)13(17)11(9-16)10-7-5-6-8-12(10)15/h5-8,11H,4H2,1-3H3 |
| InChIKey | VMORPHCSFCTPPE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |