C11H14O2 — CID 70488994
(E)-1-(4-methylphenyl)but-2-ene-1,4-diol (PubChem CID 70488994) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (E)-1-(4-methylphenyl)but-2-ene-1,4-diol.
| Compound Name | (E)-1-(4-methylphenyl)but-2-ene-1,4-diol |
|---|---|
| PubChem CID | 70488994 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (E)-1-(4-methylphenyl)but-2-ene-1,4-diol |
| SMILES | Cc1ccc(C(O)/C=C/CO)cc1 |
| InChI | InChI=1S/C11H14O2/c1-9-4-6-10(7-5-9)11(13)3-2-8-12/h2-7,11-13H,8H2,1H3/b3-2+ |
| InChIKey | CVIULMYQCWUDOQ-NSCUHMNNSA-N |
| XLogP | 1.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|