C9H8F2O — CID 58950540
1-(2,5-difluorophenyl)prop-2-en-1-ol (PubChem CID 58950540) has the molecular formula C9H8F2O and a molecular weight of 170.16 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)prop-2-en-1-ol.
| Compound Name | 1-(2,5-difluorophenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 58950540 |
| Molecular Formula | C9H8F2O |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 1-(2,5-difluorophenyl)prop-2-en-1-ol |
| SMILES | C=CC(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C9H8F2O/c1-2-9(12)7-5-6(10)3-4-8(7)11/h2-5,9,12H,1H2 |
| InChIKey | QBPGBQXZTUSKTO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|