C9H7ClF2 — CID 69215793
2-(1-chloroprop-2-enyl)-1,4-difluorobenzene (PubChem CID 69215793) has the molecular formula C9H7ClF2 and a molecular weight of 188.60 g/mol. Its IUPAC name is 2-(1-chloroprop-2-enyl)-1,4-difluorobenzene.
| Compound Name | 2-(1-chloroprop-2-enyl)-1,4-difluorobenzene |
|---|---|
| PubChem CID | 69215793 |
| Molecular Formula | C9H7ClF2 |
| Molecular Weight | 188.60 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 2-(1-chloroprop-2-enyl)-1,4-difluorobenzene |
| SMILES | C=CC(Cl)c1cc(F)ccc1F |
| InChI | InChI=1S/C9H7ClF2/c1-2-8(10)7-5-6(11)3-4-9(7)12/h2-5,8H,1H2 |
| InChIKey | BUAPWQZSFQEWPA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|