C13H4ClF7 — CID 63429945
1-[chloro-(2,5-difluorophenyl)methyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 63429945) has the molecular formula C13H4ClF7 and a molecular weight of 328.61 g/mol. Its IUPAC name is 1-[chloro-(2,5-difluorophenyl)methyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[chloro-(2,5-difluorophenyl)methyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 63429945 |
| Molecular Formula | C13H4ClF7 |
| Molecular Weight | 328.61 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 1-[chloro-(2,5-difluorophenyl)methyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | Fc1ccc(F)c(C(Cl)c2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C13H4ClF7/c14-8(5-3-4(15)1-2-6(5)16)7-9(17)11(19)13(21)12(20)10(7)18/h1-3,8H |
| InChIKey | GTSWPHSHJNBRPE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|