C11H7ClF2S — CID 61085350
3-[chloro-(2,5-difluorophenyl)methyl]thiophene (PubChem CID 61085350) has the molecular formula C11H7ClF2S and a molecular weight of 244.69 g/mol. Its IUPAC name is 3-[chloro-(2,5-difluorophenyl)methyl]thiophene.
| Compound Name | 3-[chloro-(2,5-difluorophenyl)methyl]thiophene |
|---|---|
| PubChem CID | 61085350 |
| Molecular Formula | C11H7ClF2S |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 3-[chloro-(2,5-difluorophenyl)methyl]thiophene |
| SMILES | Fc1ccc(F)c(C(Cl)c2ccsc2)c1 |
| InChI | InChI=1S/C11H7ClF2S/c12-11(7-3-4-15-6-7)9-5-8(13)1-2-10(9)14/h1-6,11H |
| InChIKey | SZCVVGUTKUDVHY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|