C13H13FO — CID 174873466
3-[(4-fluorophenyl)methyl]hexa-4,5-dien-2-one (PubChem CID 174873466) has the molecular formula C13H13FO and a molecular weight of 204.24 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]hexa-4,5-dien-2-one.
| Compound Name | 3-[(4-fluorophenyl)methyl]hexa-4,5-dien-2-one |
|---|---|
| PubChem CID | 174873466 |
| Molecular Formula | C13H13FO |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]hexa-4,5-dien-2-one |
| SMILES | C=C=CC(Cc1ccc(F)cc1)C(C)=O |
| InChI | InChI=1S/C13H13FO/c1-3-4-12(10(2)15)9-11-5-7-13(14)8-6-11/h4-8,12H,1,9H2,2H3 |
| InChIKey | JXKGJKXGLYAPHQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |