C12H16FNO — CID 167041823
N-[1-(4-fluorophenyl)butan-2-yl]acetamide (PubChem CID 167041823) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)butan-2-yl]acetamide.
| Compound Name | N-[1-(4-fluorophenyl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 167041823 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-[1-(4-fluorophenyl)butan-2-yl]acetamide |
| SMILES | CCC(Cc1ccc(F)cc1)NC(C)=O |
| InChI | InChI=1S/C12H16FNO/c1-3-12(14-9(2)15)8-10-4-6-11(13)7-5-10/h4-7,12H,3,8H2,1-2H3,(H,14,15) |
| InChIKey | HVFREBGXISVUAT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |