C13H19NO — CID 96567688
N-[(2R)-1-(4-methylphenyl)butan-2-yl]acetamide (PubChem CID 96567688) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is N-[(2R)-1-(4-methylphenyl)butan-2-yl]acetamide.
| Compound Name | N-[(2R)-1-(4-methylphenyl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 96567688 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-[(2R)-1-(4-methylphenyl)butan-2-yl]acetamide |
| SMILES | CC[C@H](Cc1ccc(C)cc1)NC(C)=O |
| InChI | InChI=1S/C13H19NO/c1-4-13(14-11(3)15)9-12-7-5-10(2)6-8-12/h5-8,13H,4,9H2,1-3H3,(H,14,15)/t13-/m1/s1 |
| InChIKey | NLNZMPIIYDRIBS-CYBMUJFWSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |