C17H25NO2S — CID 97330112
4-hydroxy-N-[(2R)-1-(4-methylphenyl)butan-2-yl]thiane-4-carboxamide (PubChem CID 97330112) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is 4-hydroxy-N-[(2R)-1-(4-methylphenyl)butan-2-yl]thiane-4-carboxamide.
| Compound Name | 4-hydroxy-N-[(2R)-1-(4-methylphenyl)butan-2-yl]thiane-4-carboxamide |
|---|---|
| PubChem CID | 97330112 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 4-hydroxy-N-[(2R)-1-(4-methylphenyl)butan-2-yl]thiane-4-carboxamide |
| SMILES | CC[C@H](Cc1ccc(C)cc1)NC(=O)C1(O)CCSCC1 |
| InChI | InChI=1S/C17H25NO2S/c1-3-15(12-14-6-4-13(2)5-7-14)18-16(19)17(20)8-10-21-11-9-17/h4-7,15,20H,3,8-12H2,1-2H3,(H,18,19)/t15-/m1/s1 |
| InChIKey | KIZRCUSTPIGENI-OAHLLOKOSA-N |
| XLogP | 2.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |