C10H12FNO4P+ — CID 175275365
[1-acetamido-2-(4-fluorophenyl)ethoxy]-hydroxy-oxophosphanium (PubChem CID 175275365) has the molecular formula C10H12FNO4P+ and a molecular weight of 260.18 g/mol. Its IUPAC name is [1-acetamido-2-(4-fluorophenyl)ethoxy]-hydroxy-oxophosphanium.
| Compound Name | [1-acetamido-2-(4-fluorophenyl)ethoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 175275365 |
| Molecular Formula | C10H12FNO4P+ |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | [1-acetamido-2-(4-fluorophenyl)ethoxy]-hydroxy-oxophosphanium |
| SMILES | CC(=O)NC(Cc1ccc(F)cc1)O[P+](=O)O |
| InChI | InChI=1S/C10H11FNO4P/c1-7(13)12-10(16-17(14)15)6-8-2-4-9(11)5-3-8/h2-5,10H,6H2,1H3,(H-,12,13,14,15)/p+1 |
| InChIKey | XAXUKCKMJABPQB-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|