C16H17FO4 — CID 77463853
2-[(4-fluorophenyl)methyl]-5-prop-2-enylhex-3-enedioic acid (PubChem CID 77463853) has the molecular formula C16H17FO4 and a molecular weight of 292.31 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-5-prop-2-enylhex-3-enedioic acid.
| Compound Name | 2-[(4-fluorophenyl)methyl]-5-prop-2-enylhex-3-enedioic acid |
|---|---|
| PubChem CID | 77463853 |
| Molecular Formula | C16H17FO4 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-5-prop-2-enylhex-3-enedioic acid |
| SMILES | C=CCC(C=CC(Cc1ccc(F)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H17FO4/c1-2-3-12(15(18)19)6-7-13(16(20)21)10-11-4-8-14(17)9-5-11/h2,4-9,12-13H,1,3,10H2,(H,18,19)(H,20,21) |
| InChIKey | APDWNTBFRAQSEL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|