C14H15FO3 — CID 102481416
ethyl 5-(4-fluorophenyl)-5-hydroxy-2-methylpenta-2,3-dienoate (PubChem CID 102481416) has the molecular formula C14H15FO3 and a molecular weight of 250.27 g/mol. Its IUPAC name is ethyl 5-(4-fluorophenyl)-5-hydroxy-2-methylpenta-2,3-dienoate.
| Compound Name | ethyl 5-(4-fluorophenyl)-5-hydroxy-2-methylpenta-2,3-dienoate |
|---|---|
| PubChem CID | 102481416 |
| Molecular Formula | C14H15FO3 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | ethyl 5-(4-fluorophenyl)-5-hydroxy-2-methylpenta-2,3-dienoate |
| SMILES | CCOC(=O)C(C)=C=CC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FO3/c1-3-18-14(17)10(2)4-9-13(16)11-5-7-12(15)8-6-11/h5-9,13,16H,3H2,1-2H3 |
| InChIKey | BSUWXIWIISJFLG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|