C16H20O3 — CID 132547329
ethyl (5S)-5-hydroxy-2,4-dimethyl-5-(4-methylphenyl)penta-2,3-dienoate (PubChem CID 132547329) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is ethyl (5S)-5-hydroxy-2,4-dimethyl-5-(4-methylphenyl)penta-2,3-dienoate.
| Compound Name | ethyl (5S)-5-hydroxy-2,4-dimethyl-5-(4-methylphenyl)penta-2,3-dienoate |
|---|---|
| PubChem CID | 132547329 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | ethyl (5S)-5-hydroxy-2,4-dimethyl-5-(4-methylphenyl)penta-2,3-dienoate |
| SMILES | CCOC(=O)C(C)=C=C(C)[C@@H](O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H20O3/c1-5-19-16(18)13(4)10-12(3)15(17)14-8-6-11(2)7-9-14/h6-9,15,17H,5H2,1-4H3/t10?,15-/m1/s1 |
| InChIKey | GZBQBNSHUDGQEQ-GENIYJEYSA-N |
| XLogP | 3.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|