C11H11FO2 — CID 15701248
1-(4-fluorophenyl)pent-2-yne-1,4-diol (PubChem CID 15701248) has the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. Its IUPAC name is 1-(4-fluorophenyl)pent-2-yne-1,4-diol.
| Compound Name | 1-(4-fluorophenyl)pent-2-yne-1,4-diol |
|---|---|
| PubChem CID | 15701248 |
| Molecular Formula | C11H11FO2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 1-(4-fluorophenyl)pent-2-yne-1,4-diol |
| SMILES | CC(O)C#CC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H11FO2/c1-8(13)2-7-11(14)9-3-5-10(12)6-4-9/h3-6,8,11,13-14H,1H3 |
| InChIKey | TWJAPPLINBYOMV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|