About 1-chlorobut-3-en-2-ol;chlorosilane
1-chlorobut-3-en-2-ol;chlorosilane (PubChem CID 173391675) has the molecular formula C4H10Cl2OSi
and a molecular weight of 173.11 g/mol. Its IUPAC name is 1-chlorobut-3-en-2-ol;chlorosilane.
Molecular Properties
| Compound Name | 1-chlorobut-3-en-2-ol;chlorosilane |
| PubChem CID | 173391675 |
| Molecular Formula | C4H10Cl2OSi |
| Molecular Weight | 173.11 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | 1-chlorobut-3-en-2-ol;chlorosilane |
| SMILES | C=CC(O)CCl.[SiH3]Cl |
| InChI | InChI=1S/C4H7ClO.ClH3Si/c1-2-4(6)3-5;1-2/h2,4,6H,1,3H2;2H3 |
| InChIKey | OWGGGNCTJDNVQG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.11 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 1-chlorobut-3-en-2-ol;chlorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorobut-3-en-2-ol;chlorosilane?
The IUPAC name of 1-chlorobut-3-en-2-ol;chlorosilane (CID 173391675) is 1-chlorobut-3-en-2-ol;chlorosilane.
What is the SMILES notation for 1-chlorobut-3-en-2-ol;chlorosilane?
The canonical SMILES for 1-chlorobut-3-en-2-ol;chlorosilane is C=CC(O)CCl.[SiH3]Cl.
What is the InChIKey of 1-chlorobut-3-en-2-ol;chlorosilane?
The InChIKey is OWGGGNCTJDNVQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClO.ClH3Si/c1-2-4(6)3-5;1-2/h2,4,6H,1,3H2;2H3.
What are the key properties of 1-chlorobut-3-en-2-ol;chlorosilane?
1-chlorobut-3-en-2-ol;chlorosilane has a molecular weight of 173.11 g/mol, XLogP of 0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorobut-3-en-2-ol;chlorosilane is sourced from PubChem (CID 173391675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).