About 7-bromohept-1-en-3-ol
7-bromohept-1-en-3-ol (PubChem CID 46179806) has the molecular formula C7H13BrO
and a molecular weight of 193.08 g/mol. Its IUPAC name is 7-bromohept-1-en-3-ol.
Molecular Properties
| Compound Name | 7-bromohept-1-en-3-ol |
| PubChem CID | 46179806 |
| Molecular Formula | C7H13BrO |
| Molecular Weight | 193.08 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | 7-bromohept-1-en-3-ol |
| SMILES | C=CC(O)CCCCBr |
| InChI | InChI=1S/C7H13BrO/c1-2-7(9)5-3-4-6-8/h2,7,9H,1,3-6H2 |
| InChIKey | RLTSBDWGAKIWFE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.08 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-bromohept-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromohept-1-en-3-ol?
The IUPAC name of 7-bromohept-1-en-3-ol (CID 46179806) is 7-bromohept-1-en-3-ol.
What is the SMILES notation for 7-bromohept-1-en-3-ol?
The canonical SMILES for 7-bromohept-1-en-3-ol is C=CC(O)CCCCBr.
What is the InChIKey of 7-bromohept-1-en-3-ol?
The InChIKey is RLTSBDWGAKIWFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13BrO/c1-2-7(9)5-3-4-6-8/h2,7,9H,1,3-6H2.
What are the key properties of 7-bromohept-1-en-3-ol?
7-bromohept-1-en-3-ol has a molecular weight of 193.08 g/mol, XLogP of 2.10, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromohept-1-en-3-ol is sourced from PubChem (CID 46179806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).