C17H23BrO3 — CID 23946853
(1R,7R)-1-(5-bromo-2-hydroxyphenyl)-5,8-dimethylnona-3,4-diene-1,7-diol (PubChem CID 23946853) has the molecular formula C17H23BrO3 and a molecular weight of 355.27 g/mol. Its IUPAC name is (1R,7R)-1-(5-bromo-2-hydroxyphenyl)-5,8-dimethylnona-3,4-diene-1,7-diol.
| Compound Name | (1R,7R)-1-(5-bromo-2-hydroxyphenyl)-5,8-dimethylnona-3,4-diene-1,7-diol |
|---|---|
| PubChem CID | 23946853 |
| Molecular Formula | C17H23BrO3 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | (1R,7R)-1-(5-bromo-2-hydroxyphenyl)-5,8-dimethylnona-3,4-diene-1,7-diol |
| SMILES | CC(=C=CC[C@@H](O)c1cc(Br)ccc1O)C[C@@H](O)C(C)C |
| InChI | InChI=1S/C17H23BrO3/c1-11(2)17(21)9-12(3)5-4-6-15(19)14-10-13(18)7-8-16(14)20/h4,7-8,10-11,15,17,19-21H,6,9H2,1-3H3/t5?,15-,17-/m1/s1 |
| InChIKey | KOMWEGDBUKDHNL-MSURPENWSA-N |
| XLogP | 4.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |