C11H14BrNO4 — CID 53359902
4-bromo-2-[(2R,3S)-4-hydroxy-3-methyl-1-nitrobutan-2-yl]phenol (PubChem CID 53359902) has the molecular formula C11H14BrNO4 and a molecular weight of 304.14 g/mol. Its IUPAC name is 4-bromo-2-[(2R,3S)-4-hydroxy-3-methyl-1-nitrobutan-2-yl]phenol.
| Compound Name | 4-bromo-2-[(2R,3S)-4-hydroxy-3-methyl-1-nitrobutan-2-yl]phenol |
|---|---|
| PubChem CID | 53359902 |
| Molecular Formula | C11H14BrNO4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 4-bromo-2-[(2R,3S)-4-hydroxy-3-methyl-1-nitrobutan-2-yl]phenol |
| SMILES | C[C@H](CO)[C@@H](C[N+](=O)[O-])c1cc(Br)ccc1O |
| InChI | InChI=1S/C11H14BrNO4/c1-7(6-14)10(5-13(16)17)9-4-8(12)2-3-11(9)15/h2-4,7,10,14-15H,5-6H2,1H3/t7-,10-/m1/s1 |
| InChIKey | TWUDOUCXXUXGNS-GMSGAONNSA-N |
| XLogP | 2.14 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|