C9H14O — CID 130128608
1-Cyclopentylbuta-2,3-dien-1-ol (PubChem CID 130128608) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol.
| Compound Name | 1-Cyclopentylbuta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 130128608 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | — |
| SMILES | C=C=CC(O)C1CCCC1 |
| InChI | InChI=1S/C9H14O/c1-2-5-9(10)8-6-3-4-7-8/h5,8-10H,1,3-4,6-7H2 |
| InChIKey | IQWZNKLVKUJYHC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |