C17H30O2 — CID 46914637
(Z,1S,5S)-1,5-dicyclohexylpent-2-ene-1,5-diol (PubChem CID 46914637) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (Z,1S,5S)-1,5-dicyclohexylpent-2-ene-1,5-diol.
| Compound Name | (Z,1S,5S)-1,5-dicyclohexylpent-2-ene-1,5-diol |
|---|---|
| PubChem CID | 46914637 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (Z,1S,5S)-1,5-dicyclohexylpent-2-ene-1,5-diol |
| SMILES | O[C@H](/C=C\C[C@H](O)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H30O2/c18-16(14-8-3-1-4-9-14)12-7-13-17(19)15-10-5-2-6-11-15/h7,12,14-19H,1-6,8-11,13H2/b12-7-/t16-,17+/m1/s1 |
| InChIKey | SRCGUKDIQPHBCG-FFYLZMLBSA-N |
| XLogP | 3.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|