C16H26O2 — CID 12063945
(1R,4R)-1,4-dicyclohexylbut-2-yne-1,4-diol (PubChem CID 12063945) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (1R,4R)-1,4-dicyclohexylbut-2-yne-1,4-diol.
| Compound Name | (1R,4R)-1,4-dicyclohexylbut-2-yne-1,4-diol |
|---|---|
| PubChem CID | 12063945 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (1R,4R)-1,4-dicyclohexylbut-2-yne-1,4-diol |
| SMILES | O[C@@H](C#C[C@H](O)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H26O2/c17-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h13-18H,1-10H2/t15-,16-/m0/s1 |
| InChIKey | XPFSGHNYNKITHN-HOTGVXAUSA-N |
| XLogP | 2.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|