C12H20O2 — CID 134861232
1-cyclopentylhept-2-yne-1,7-diol (PubChem CID 134861232) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-cyclopentylhept-2-yne-1,7-diol.
| Compound Name | 1-cyclopentylhept-2-yne-1,7-diol |
|---|---|
| PubChem CID | 134861232 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 1-cyclopentylhept-2-yne-1,7-diol |
| SMILES | OCCCCC#CC(O)C1CCCC1 |
| InChI | InChI=1S/C12H20O2/c13-10-6-2-1-3-9-12(14)11-7-4-5-8-11/h11-14H,1-2,4-8,10H2 |
| InChIKey | RFWVLYUVKQVRNU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|