About 1-cyclopentylhex-2-yne-1,6-diol
1-cyclopentylhex-2-yne-1,6-diol (PubChem CID 134846390) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 1-cyclopentylhex-2-yne-1,6-diol.
Molecular Properties
| Compound Name | 1-cyclopentylhex-2-yne-1,6-diol |
| PubChem CID | 134846390 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 1-cyclopentylhex-2-yne-1,6-diol |
| SMILES | OCCCC#CC(O)C1CCCC1 |
| InChI | InChI=1S/C11H18O2/c12-9-5-1-2-8-11(13)10-6-3-4-7-10/h10-13H,1,3-7,9H2 |
| InChIKey | AVOQHRQLGQESDJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentylhex-2-yne-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylhex-2-yne-1,6-diol?
The IUPAC name of 1-cyclopentylhex-2-yne-1,6-diol (CID 134846390) is 1-cyclopentylhex-2-yne-1,6-diol.
What is the SMILES notation for 1-cyclopentylhex-2-yne-1,6-diol?
The canonical SMILES for 1-cyclopentylhex-2-yne-1,6-diol is OCCCC#CC(O)C1CCCC1.
What is the InChIKey of 1-cyclopentylhex-2-yne-1,6-diol?
The InChIKey is AVOQHRQLGQESDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c12-9-5-1-2-8-11(13)10-6-3-4-7-10/h10-13H,1,3-7,9H2.
What are the key properties of 1-cyclopentylhex-2-yne-1,6-diol?
1-cyclopentylhex-2-yne-1,6-diol has a molecular weight of 182.26 g/mol, XLogP of 1.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylhex-2-yne-1,6-diol is sourced from PubChem (CID 134846390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).