C25H43IOSi — CID 134940739
[(3S,4E,8E,12E)-13-iodo-5,9,12-trimethyltrideca-4,8,12-trien-1-yn-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 134940739) has the molecular formula C25H43IOSi and a molecular weight of 514.61 g/mol. Its IUPAC name is [(3S,4E,8E,12E)-13-iodo-5,9,12-trimethyltrideca-4,8,12-trien-1-yn-3-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3S,4E,8E,12E)-13-iodo-5,9,12-trimethyltrideca-4,8,12-trien-1-yn-3-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134940739 |
| Molecular Formula | C25H43IOSi |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | [(3S,4E,8E,12E)-13-iodo-5,9,12-trimethyltrideca-4,8,12-trien-1-yn-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C#C[C@H](/C=C(\C)CC/C=C(\C)CC/C(C)=C/I)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H43IOSi/c1-11-25(27-28(19(2)3,20(4)5)21(6)7)17-23(9)14-12-13-22(8)15-16-24(10)18-26/h1,13,17-21,25H,12,14-16H2,2-10H3/b22-13+,23-17+,24-18+/t25-/m1/s1 |
| InChIKey | HKFZRASSIOUYGA-QNPSMAEPSA-N |
| XLogP | 8.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|