C21H41IOSi2 — CID 25111621
[(E,3R,4S)-8-iodo-3-methyl-1-trimethylsilyloct-5-en-1-yn-4-yl]oxy-tri(propan-2-yl)silane (PubChem CID 25111621) has the molecular formula C21H41IOSi2 and a molecular weight of 492.63 g/mol. Its IUPAC name is [(E,3R,4S)-8-iodo-3-methyl-1-trimethylsilyloct-5-en-1-yn-4-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(E,3R,4S)-8-iodo-3-methyl-1-trimethylsilyloct-5-en-1-yn-4-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 25111621 |
| Molecular Formula | C21H41IOSi2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | [(E,3R,4S)-8-iodo-3-methyl-1-trimethylsilyloct-5-en-1-yn-4-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@@H](/C=C/CCI)[C@H](C)C#C[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H41IOSi2/c1-17(2)25(18(3)4,19(5)6)23-21(13-11-12-15-22)20(7)14-16-24(8,9)10/h11,13,17-21H,12,15H2,1-10H3/b13-11+/t20-,21+/m1/s1 |
| InChIKey | UCMKKXVWGRNZAX-DYEAYBGSSA-N |
| XLogP | 7.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|