C21H41IOSi — CID 122211712
triethyl-[(3E,5R,6R,7E,9R)-1-iodo-5,7,9-trimethyldodeca-3,7-dien-6-yl]oxysilane (PubChem CID 122211712) has the molecular formula C21H41IOSi and a molecular weight of 464.55 g/mol. Its IUPAC name is triethyl-[(3E,5R,6R,7E,9R)-1-iodo-5,7,9-trimethyldodeca-3,7-dien-6-yl]oxysilane.
| Compound Name | triethyl-[(3E,5R,6R,7E,9R)-1-iodo-5,7,9-trimethyldodeca-3,7-dien-6-yl]oxysilane |
|---|---|
| PubChem CID | 122211712 |
| Molecular Formula | C21H41IOSi |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | triethyl-[(3E,5R,6R,7E,9R)-1-iodo-5,7,9-trimethyldodeca-3,7-dien-6-yl]oxysilane |
| SMILES | CCC[C@@H](C)/C=C(\C)[C@H](O[Si](CC)(CC)CC)[C@H](C)/C=C/CCI |
| InChI | InChI=1S/C21H41IOSi/c1-8-14-18(5)17-20(7)21(19(6)15-12-13-16-22)23-24(9-2,10-3)11-4/h12,15,17-19,21H,8-11,13-14,16H2,1-7H3/b15-12+,20-17+/t18-,19-,21-/m1/s1 |
| InChIKey | OIWTZZLGNWCFKJ-UZBYNTMUSA-N |
| XLogP | 7.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|