C14H29IOSi — CID 134898049
tert-butyl-[(E,3R,4R)-6-iodo-4-methylhept-5-en-3-yl]oxy-dimethylsilane (PubChem CID 134898049) has the molecular formula C14H29IOSi and a molecular weight of 368.38 g/mol. Its IUPAC name is tert-butyl-[(E,3R,4R)-6-iodo-4-methylhept-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,3R,4R)-6-iodo-4-methylhept-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134898049 |
| Molecular Formula | C14H29IOSi |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | tert-butyl-[(E,3R,4R)-6-iodo-4-methylhept-5-en-3-yl]oxy-dimethylsilane |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(\C)I |
| InChI | InChI=1S/C14H29IOSi/c1-9-13(11(2)10-12(3)15)16-17(7,8)14(4,5)6/h10-11,13H,9H2,1-8H3/b12-10+/t11-,13-/m1/s1 |
| InChIKey | ZMTPVSVCFMWJAQ-ZGDCTCODSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|