C20H37IOSi — CID 134865846
tert-butyl-[(3R,4R,5E,7E,9Z)-10-iodo-4,6,8-trimethylundeca-5,7,9-trien-3-yl]oxy-dimethylsilane (PubChem CID 134865846) has the molecular formula C20H37IOSi and a molecular weight of 448.51 g/mol. Its IUPAC name is tert-butyl-[(3R,4R,5E,7E,9Z)-10-iodo-4,6,8-trimethylundeca-5,7,9-trien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4R,5E,7E,9Z)-10-iodo-4,6,8-trimethylundeca-5,7,9-trien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134865846 |
| Molecular Formula | C20H37IOSi |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | tert-butyl-[(3R,4R,5E,7E,9Z)-10-iodo-4,6,8-trimethylundeca-5,7,9-trien-3-yl]oxy-dimethylsilane |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(C)/C=C(C)/C=C(/C)I |
| InChI | InChI=1S/C20H37IOSi/c1-11-19(22-23(9,10)20(6,7)8)17(4)13-15(2)12-16(3)14-18(5)21/h12-14,17,19H,11H2,1-10H3/b15-13+,16-12+,18-14-/t17-,19-/m1/s1 |
| InChIKey | IGPDINLMJBEHGY-AYMGAGGXSA-N |
| XLogP | 7.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|