C22H45IO2Si2 — CID 134982119
tert-butyl-[(2R,3R,4E,6E)-2-[tert-butyl(dimethyl)silyl]oxy-7-iodo-3,5,6-trimethylhepta-4,6-dienoxy]-dimethylsilane (PubChem CID 134982119) has the molecular formula C22H45IO2Si2 and a molecular weight of 524.68 g/mol. Its IUPAC name is tert-butyl-[(2R,3R,4E,6E)-2-[tert-butyl(dimethyl)silyl]oxy-7-iodo-3,5,6-trimethylhepta-4,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R,4E,6E)-2-[tert-butyl(dimethyl)silyl]oxy-7-iodo-3,5,6-trimethylhepta-4,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134982119 |
| Molecular Formula | C22H45IO2Si2 |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | tert-butyl-[(2R,3R,4E,6E)-2-[tert-butyl(dimethyl)silyl]oxy-7-iodo-3,5,6-trimethylhepta-4,6-dienoxy]-dimethylsilane |
| SMILES | CC(=C\I)/C(C)=C/[C@@H](C)[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H45IO2Si2/c1-17(19(3)15-23)14-18(2)20(25-27(12,13)22(7,8)9)16-24-26(10,11)21(4,5)6/h14-15,18,20H,16H2,1-13H3/b17-14+,19-15+/t18-,20+/m1/s1 |
| InChIKey | HMMSDNMLMFDLEV-RMDPSJRESA-N |
| XLogP | 8.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|