C22H47IO2Si2 — CID 87797735
tert-butyl-[(Z,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,4,6-trimethylhept-5-enoxy]-dimethylsilane (PubChem CID 87797735) has the molecular formula C22H47IO2Si2 and a molecular weight of 526.69 g/mol. Its IUPAC name is tert-butyl-[(Z,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,4,6-trimethylhept-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,4,6-trimethylhept-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 87797735 |
| Molecular Formula | C22H47IO2Si2 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | tert-butyl-[(Z,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,4,6-trimethylhept-5-enoxy]-dimethylsilane |
| SMILES | C/C(=C/[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C)CI |
| InChI | InChI=1S/C22H47IO2Si2/c1-17(15-23)14-18(2)20(25-27(12,13)22(7,8)9)19(3)16-24-26(10,11)21(4,5)6/h14,18-20H,15-16H2,1-13H3/b17-14-/t18-,19-,20+/m0/s1 |
| InChIKey | NLDRADVTRFVCCM-LGIUGZTISA-N |
| XLogP | 8.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|