C22H46O2Si2 — CID 134950605
tert-butyl-[(2S,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhepta-4,6-dienoxy]-dimethylsilane (PubChem CID 134950605) has the molecular formula C22H46O2Si2 and a molecular weight of 398.78 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhepta-4,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhepta-4,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134950605 |
| Molecular Formula | C22H46O2Si2 |
| Molecular Weight | 398.78 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | tert-butyl-[(2S,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhepta-4,6-dienoxy]-dimethylsilane |
| SMILES | C=C(C)/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O2Si2/c1-17(2)15-18(3)20(24-26(13,14)22(8,9)10)19(4)16-23-25(11,12)21(5,6)7/h15,19-20H,1,16H2,2-14H3/b18-15+/t19-,20+/m0/s1 |
| InChIKey | DCIHTAVNGRATNG-MSLZVHJSSA-N |
| XLogP | 7.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.78 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|