C29H54O2SiSn — CID 16757120
tert-butyl-[(1Z,3E,5R,6R,7S,8E,10E)-7-methoxy-2,6,8-trimethyl-1-trimethylstannylhexadeca-1,3,8,10,15-pentaen-5-yl]oxy-dimethylsilane (PubChem CID 16757120) has the molecular formula C29H54O2SiSn and a molecular weight of 581.55 g/mol. Its IUPAC name is tert-butyl-[(1Z,3E,5R,6R,7S,8E,10E)-7-methoxy-2,6,8-trimethyl-1-trimethylstannylhexadeca-1,3,8,10,15-pentaen-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1Z,3E,5R,6R,7S,8E,10E)-7-methoxy-2,6,8-trimethyl-1-trimethylstannylhexadeca-1,3,8,10,15-pentaen-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 16757120 |
| Molecular Formula | C29H54O2SiSn |
| Molecular Weight | 581.55 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | tert-butyl-[(1Z,3E,5R,6R,7S,8E,10E)-7-methoxy-2,6,8-trimethyl-1-trimethylstannylhexadeca-1,3,8,10,15-pentaen-5-yl]oxy-dimethylsilane |
| SMILES | C=CCCC/C=C/C=C(\C)[C@@H](OC)[C@@H](C)[C@@H](/C=C/C(C)=C\[Sn](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H45O2Si.3CH3.Sn/c1-12-13-14-15-16-17-18-22(4)25(27-9)23(5)24(20-19-21(2)3)28-29(10,11)26(6,7)8;;;;/h2,12,16-20,23-25H,1,13-15H2,3-11H3;3*1H3;/b17-16+,20-19+,21-2?,22-18+;;;;/t23-,24+,25+;;;;/m0..../s1 |
| InChIKey | FWXQKJWQYAYOGV-UVMZUDJFSA-N |
| XLogP | 9.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.55 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|