C27H50O2SiSn — CID 135017274
tert-butyl-[(1Z,3E,5R,6R,7S,8Z,10E)-7-methoxy-2,6,8-trimethyl-1-trimethylstannyltetradeca-1,3,8,10,13-pentaen-5-yl]oxy-dimethylsilane (PubChem CID 135017274) has the molecular formula C27H50O2SiSn and a molecular weight of 553.49 g/mol. Its IUPAC name is tert-butyl-[(1Z,3E,5R,6R,7S,8Z,10E)-7-methoxy-2,6,8-trimethyl-1-trimethylstannyltetradeca-1,3,8,10,13-pentaen-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1Z,3E,5R,6R,7S,8Z,10E)-7-methoxy-2,6,8-trimethyl-1-trimethylstannyltetradeca-1,3,8,10,13-pentaen-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135017274 |
| Molecular Formula | C27H50O2SiSn |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | tert-butyl-[(1Z,3E,5R,6R,7S,8Z,10E)-7-methoxy-2,6,8-trimethyl-1-trimethylstannyltetradeca-1,3,8,10,13-pentaen-5-yl]oxy-dimethylsilane |
| SMILES | C=CC/C=C/C=C(/C)[C@@H](OC)[C@@H](C)[C@@H](/C=C/C(C)=C\[Sn](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H41O2Si.3CH3.Sn/c1-12-13-14-15-16-20(4)23(25-9)21(5)22(18-17-19(2)3)26-27(10,11)24(6,7)8;;;;/h2,12,14-18,21-23H,1,13H2,3-11H3;3*1H3;/b15-14+,18-17+,19-2?,20-16-;;;;/t21-,22+,23+;;;;/m0..../s1 |
| InChIKey | WXIICSIWXLQWBO-DZSMLYNGSA-N |
| XLogP | 8.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|