C39H80O3Si2Sn — CID 135036512
tert-butyl-[(2S,3E,5E,7S,8R,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,6,8-trimethyl-11-tributylstannylundeca-3,5,10-trienoxy]-dimethylsilane (PubChem CID 135036512) has the molecular formula C39H80O3Si2Sn and a molecular weight of 771.95 g/mol. Its IUPAC name is tert-butyl-[(2S,3E,5E,7S,8R,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,6,8-trimethyl-11-tributylstannylundeca-3,5,10-trienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3E,5E,7S,8R,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,6,8-trimethyl-11-tributylstannylundeca-3,5,10-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135036512 |
| Molecular Formula | C39H80O3Si2Sn |
| Molecular Weight | 771.95 g/mol |
| Exact Mass | 772.47 |
| IUPAC Name | tert-butyl-[(2S,3E,5E,7S,8R,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,6,8-trimethyl-11-tributylstannylundeca-3,5,10-trienoxy]-dimethylsilane |
| SMILES | CCCC[Sn](/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](OC)/C(C)=C/C=C/[C@H](C)CO[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C27H53O3Si2.3C4H9.Sn/c1-16-24(30-32(14,15)27(8,9)10)23(4)25(28-11)22(3)19-17-18-21(2)20-29-31(12,13)26(5,6)7;3*1-3-4-2;/h1,16-19,21,23-25H,20H2,2-15H3;3*1,3-4H2,2H3;/b16-1?,18-17+,22-19+;;;;/t21-,23-,24+,25+;;;;/m0..../s1 |
| InChIKey | BSPLTCRNHHACAF-VDFICXDNSA-N |
| XLogP | 13.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.95 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|