C36H72O3Si2Sn — CID 172847084
tert-butyl-[(Z,1S,3S)-2,2-dimethyl-1-[(E)-prop-1-enyl]-6-[(2R,3S)-3-[(E)-2-tributylstannylethenyl]oxiran-2-yl]-3-trimethylsilyloxyhex-5-enoxy]-dimethylsilane (PubChem CID 172847084) has the molecular formula C36H72O3Si2Sn and a molecular weight of 727.85 g/mol. Its IUPAC name is tert-butyl-[(Z,1S,3S)-2,2-dimethyl-1-[(E)-prop-1-enyl]-6-[(2R,3S)-3-[(E)-2-tributylstannylethenyl]oxiran-2-yl]-3-trimethylsilyloxyhex-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,1S,3S)-2,2-dimethyl-1-[(E)-prop-1-enyl]-6-[(2R,3S)-3-[(E)-2-tributylstannylethenyl]oxiran-2-yl]-3-trimethylsilyloxyhex-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 172847084 |
| Molecular Formula | C36H72O3Si2Sn |
| Molecular Weight | 727.85 g/mol |
| Exact Mass | 728.40 |
| IUPAC Name | tert-butyl-[(Z,1S,3S)-2,2-dimethyl-1-[(E)-prop-1-enyl]-6-[(2R,3S)-3-[(E)-2-tributylstannylethenyl]oxiran-2-yl]-3-trimethylsilyloxyhex-5-enoxy]-dimethylsilane |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H](C/C=C\[C@H]1O[C@H]1/C=C/[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C24H45O3Si2.3C4H9.Sn/c1-13-16-21(27-29(11,12)23(3,4)5)24(6,7)22(26-28(8,9)10)18-15-17-20-19(14-2)25-20;3*1-3-4-2;/h2,13-17,19-22H,18H2,1,3-12H3;3*1,3-4H2,2H3;/b14-2?,16-13+,17-15-;;;;/t19-,20+,21-,22-;;;;/m0..../s1 |
| InChIKey | XOKHQALWKAXFKU-AFTQBKTKSA-N |
| XLogP | 11.86 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.85 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|